A8401412
2-Fluoro-4-(trifluoromethyl)benzoic acid , 98% , 115029-24-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB479.20 | In Stock |
|
| 100g | RMB1823.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 168-170 °C(lit.) |
| Boiling point: | 231.4±40.0 °C(Predicted) |
| Density | 1.4412 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | crystals |
| pka | 2.76±0.10(Predicted) |
| color | White |
| BRN | 8409774 |
| InChI | InChI=1S/C8H4F4O2/c9-6-3-4(8(10,11)12)1-2-5(6)7(13)14/h1-3H,(H,13,14) |
| InChIKey | OCIYTBZXTFPSPI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(C(F)(F)F)C=C1F |
| CAS DataBase Reference | 115029-24-8(CAS DataBase Reference) |
Description and Uses
The molecular properties (both steric as well as electronic) of 2-fluoro-4-(trifluoromethyl)benzoic acid has been studied using molecular orbital and empirical methods.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-37/38-36 |
| Safety Statements | 26-37/39-36/37/39-27 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







