A8402712
3-Cyclopentylpropionic acid , 98% , 140-77-2
Synonym(s):
Cyclopentanepropionic acid
CAS NO.:140-77-2
Empirical Formula: C8H14O2
Molecular Weight: 142.2
MDL number: MFCD00001392
EINECS: 205-433-0
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB36.80 | In Stock |
|
| 25ML | RMB123.20 | In Stock |
|
| 100ML | RMB346.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131 °C |
| Boiling point: | 130-132 °C/12 mmHg (lit.) |
| Density | 0.996 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 116 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.81±0.10(Predicted) |
| form | Liquid |
| color | Clear colorless to yellow |
| Water Solubility | insoluble |
| InChI | InChI=1S/C8H14O2/c9-8(10)6-5-7-3-1-2-4-7/h7H,1-6H2,(H,9,10) |
| InChIKey | ZRPLANDPDWYOMZ-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)CCCC1 |
| CAS DataBase Reference | 140-77-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Cyclopentanepropanoic acid(140-77-2) |
| EPA Substance Registry System | Cyclopentanepropanoic acid (140-77-2) |
Description and Uses
3-Cyclopentylpropionic acid can be used as an organic building blocks in the synthesis of variety of pharmaceutical compound. It is used for the synthesis of Testosterone Cypionate (T155100).
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36-24/25 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29162090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |





