A8403012
3-(Boc-amino)cyclobutanone , 95% , 154748-49-9
Synonym(s):
(3-Oxocyclobutyl)carbamic acid tert-butyl ester
CAS NO.:154748-49-9
Empirical Formula: C9H15NO3
Molecular Weight: 185.22
MDL number: MFCD09751872
EINECS: 817-050-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB34.40 | In Stock |
|
| 1G | RMB84.80 | In Stock |
|
| 5G | RMB196.00 | In Stock |
|
| 25g | RMB1197.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 120-125℃ |
| Boiling point: | 302.1±31.0 °C(Predicted) |
| Density | 1.10±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 11.60±0.20(Predicted) |
| color | Light yellow to Yellow to Orange |
| InChI | InChI=1S/C9H15NO3/c1-9(2,3)13-8(12)10-6-4-7(11)5-6/h6H,4-5H2,1-3H3,(H,10,12) |
| InChIKey | FNHPTFKSPUTESA-UHFFFAOYSA-N |
| SMILES | C(OC(C)(C)C)(=O)NC1CC(=O)C1 |
Description and Uses
tert-Butyl (3-Oxocyclobutyl)carbamate is used in the preparation of 5-HT1-like receptor agonists. It is also used to synthesize (oxadiazolyl)quinoline derivatives as highly potent HCV NS4B inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| Risk Statements | 52-51/53-36/37/38 |
| Safety Statements | 3/9-4-22-26-28-29-35-44 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







