A8403312
4,4-Difluorocyclohexanecarboxylic acid , 98% , 122665-97-8
CAS NO.:122665-97-8
Empirical Formula: C7H10F2O2
Molecular Weight: 164.15
MDL number: MFCD03788493
EINECS: 602-802-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB96.00 | In Stock |
|
| 25G | RMB379.20 | In Stock |
|
| 100g | RMB1388.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 103-107 °C |
| Boiling point: | 241.1±40.0 °C(Predicted) |
| Density | 1.24±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform, Methanol |
| pka | 4.06±0.10(Predicted) |
| form | Solid |
| color | White |
| InChI | InChI=1S/C7H10F2O2/c8-7(9)3-1-5(2-4-7)6(10)11/h5H,1-4H2,(H,10,11) |
| InChIKey | HYIUDFLDFSIXTR-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)CCC(F)(F)CC1 |
| CAS DataBase Reference | 122665-97-8(CAS DataBase Reference) |
Description and Uses
4,4-Difluorocyclohexanecarboxylic acid is a di-substituted cyclohexane carboxylic acids used in the synthesis of macrolide antibiotics.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29161900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |



