A8406512
3,6-Dichloro-4-methylpyridazine , 97% , 19064-64-3
CAS NO.:19064-64-3
Empirical Formula: C5H4Cl2N2
Molecular Weight: 163
MDL number: MFCD00006465
EINECS: 242-794-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB34.40 | In Stock |
|
| 25G | RMB127.20 | In Stock |
|
| 100G | RMB428.80 | In Stock |
|
| 500g | RMB2039.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 86-88 °C (lit.) |
| Boiling point: | 149-151 °C/21 mmHg (lit.) |
| Density | 1.5462 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| Flash point: | 149-151°C/21mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| pka | -0.56±0.10(Predicted) |
| color | Brown |
| BRN | 119573 |
| InChI | InChI=1S/C5H4Cl2N2/c1-3-2-4(6)8-9-5(3)7/h2H,1H3 |
| InChIKey | ROYHWGZNGMXQEU-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NN=C(Cl)C=C1C |
| CAS DataBase Reference | 19064-64-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Pyridazine, 3,6-dichloro-4-methyl-(19064-64-3) |
Description and Uses
3,6-Dichloro-4-methylpyridazine has been used in the synthesis of 7-methyl-2-phenylimidazo[1,2-b]pyridazine-3-carboxylic acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-37/39-36/37/39-22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![Methyl 1H-pyrrolo[2,3-b]pyridine-6-carboxylate](https://img.chemicalbook.com/CAS/GIF/1256825-86-1.gif)


