A8406632
2-Chloro-5-(trifluoromethyl)phenyl isothiocyanate , 98% , 23165-49-3
CAS NO.:23165-49-3
Empirical Formula: C8H3ClF3NS
Molecular Weight: 237.63
MDL number: MFCD00041055
EINECS: 623-226-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB239.20 | In Stock |
|
| 5G | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 239 °C(lit.) |
| Density | 1.447 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Keep Cold |
| Specific Gravity | 1.450 |
| Sensitive | Stench |
| BRN | 2112809 |
| InChI | 1S/C8H3ClF3NS/c9-6-2-1-5(8(10,11)12)3-7(6)13-4-14/h1-3H |
| InChIKey | KHTMKXDMVYHDSY-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1ccc(Cl)c(c1)N=C=S |
| CAS DataBase Reference | 23165-49-3(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-(trifluoromethyl)phenyl isothiocyanate is an organic building block. Its enthalpy of vaporization at boiling point (512.15K) has been reported to be 45.053kjoule/mol.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,T |
| Risk Statements | 34-36/37/38-20/21/22 |
| Safety Statements | 23-26-36/37/39-45-26/37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Harmful/Stench |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |







