A8406712
3-(Boc-aminomethyl)benzoic acid , ≥97.0%(HPLC) , 117445-22-4
CAS NO.:117445-22-4
Empirical Formula: C13H17NO4
Molecular Weight: 251.28
MDL number: MFCD00273426
EINECS: 820-537-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB114.40 | In Stock |
|
| 5G | RMB540.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 434.6±38.0 °C(Predicted) |
| Density | 1.178±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.21±0.10(Predicted) |
| form | Crystalline Powder or Flakes |
| color | White to off-white |
| BRN | 6957774 |
| Major Application | peptide synthesis |
| InChI | 1S/C13H17NO4/c1-13(2,3)18-12(17)14-8-9-5-4-6-10(7-9)11(15)16/h4-7H,8H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | MQNHKLMHRZYTBZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCc1cccc(c1)C(O)=O |
| CAS DataBase Reference | 117445-22-4(CAS DataBase Reference) |
Description and Uses
3-(Boc-aminomethyl)benzoic Acid is used to synthesize aminodihydroquinazolines as inhibitors of BACE-1 (β-site APP cleaving enzyme). It is also used to prepare spiro[1H-indene-1,4''-piperidine] derivatives as potent and selective non-peptide human somatostatin receptor subtype 2 (sst2) agonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |





