A8408512
4-bromo-2,6-dimethylpyridine , ≥98% , 5093-70-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB80.00 | In Stock |
|
| 5G | RMB235.20 | In Stock |
|
| 25G | RMB774.40 | In Stock |
|
| 100G | RMB2271.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 28-32°C |
| Boiling point: | 194 °C |
| Density | 1.415±0.06 g/cm3(Predicted) |
| Flash point: | 93℃ |
| storage temp. | 2-8°C |
| form | solid |
| pka | 5.41±0.10(Predicted) |
| Appearance | Colorless to off-white <28°C Solid,>32°C Liquid |
| InChI | InChI=1S/C7H8BrN/c1-5-3-7(8)4-6(2)9-5/h3-4H,1-2H3 |
| InChIKey | VTRFAYHJKSKHGY-UHFFFAOYSA-N |
| SMILES | C1(C)=NC(C)=CC(Br)=C1 |
Description and Uses
4-Bromo-2,6-dimethylpyridine is a reagent used in the synthesis of novel isoquinoline derivatives of potential interest for pharmaceutical, biomedical, and energy-related research.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 22-41-37/38 |
| Safety Statements | 26-39-24/25 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |






