A8411312
2,4-Dimethoxy-1-nitrobenzene , 97% , 4920-84-7
CAS NO.：4920-84-7
Empirical Formula: C8H9NO4
Molecular Weight: 183.16
MDL number: MFCD00024210
EINECS: 225-551-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB67.20 | In Stock |
|
| 5G | RMB192.00 | In Stock |
|
| 25G | RMB778.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-76 °C(lit.) |
| Boiling point: | 256.82°C (rough estimate) |
| Density | 1.1876 |
| refractive index | 1.5310 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene |
| form | powder to crystal |
| color | Light orange to Yellow to Green |
| InChI | InChI=1S/C8H9NO4/c1-12-6-3-4-7(9(10)11)8(5-6)13-2/h3-5H,1-2H3 |
| InChIKey | XXWIYOBCHKCWNT-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=CC=C(OC)C=C1OC |
| CAS DataBase Reference | 4920-84-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P271-P260-P280 |
| Safety Statements | 24/25-22 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HS Code | 29093090 |
