A8411412
5-Methoxy-2-methylaniline , 97% , 50868-72-9
Synonym(s):
6-Methyl-m-anisidine
CAS NO.:50868-72-9
Empirical Formula: C8H11NO
Molecular Weight: 137.18
MDL number: MFCD00075057
EINECS: 256-816-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB74.40 | In Stock |
|
| 5G | RMB219.20 | In Stock |
|
| 25G | RMB2079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 43-46 °C (lit.) |
| Boiling point: | 253°C(lit.) |
| Density | 1.0630 (rough estimate) |
| refractive index | 1.5647 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Powder |
| pka | 4.03±0.10(Predicted) |
| color | Off-white to pale grey to yellow |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C8H11NO/c1-6-3-4-7(10-2)5-8(6)9/h3-5H,9H2,1-2H3 |
| InChIKey | RPJXLEZOFUNGNZ-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(OC)=CC=C1C |
Description and Uses
5-Methoxy-2-methylaniline was used in the preparation of N-(5-methoxy-2-methylphenyl)acetamide.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H331-H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338-P304+P340-P405-P501a |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29222990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






