A8414912
5-Methyl-5-phenylhydantoin , 99% , 6843-49-8
Synonym(s):
5-Methyl-5-phenylhydantoin;5-Methyl-5-phenylimidazolidine-2,4-dione;NSC 14839
CAS NO.:6843-49-8
Empirical Formula: C10H10N2O2
Molecular Weight: 190.2
MDL number: MFCD00005265
EINECS: 229-928-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB64.80 | In Stock |
|
| 5G | RMB274.40 | In Stock |
|
| 25g | RMB1132.00 | In Stock |
|
| 100g | RMB3199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 199-201 °C (lit.) |
| Boiling point: | 325.7°C (rough estimate) |
| Density | 1.2167 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| Flash point: | 9℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| pka | 8.60±0.10(Predicted) |
| form | Crystalline Powder |
| color | White |
| InChI | InChI=1S/C10H10N2O2/c1-10(7-5-3-2-4-6-7)8(13)11-9(14)12-10/h2-6H,1H3,(H2,11,12,13,14) |
| InChIKey | JNGWGQUYLVSFND-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(C)(C2=CC=CC=C2)C(=O)N1 |
Description and Uses
5-Methyl-5-phenylhydantoin is a reactant for synthesis of beta-amino alcohols as inhibitors of anti-tubercular target N-acetyltransferase, chlorohydantoins and specific MMP inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H319 |
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 |
| Hazard Codes | Xn |
| Risk Statements | 22-36 |
| Safety Statements | 24/25-26 |
| RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution |
| WGK Germany | 3 |
| RTECS | MU2625500 |
| HS Code | 29332100 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 |
| Toxicity | LD50 subcutaneous in mouse: 560mg/kg |






