PRODUCT Properties
| Boiling point: | 312.9±15.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | solid |
| pka | 4.22±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Sensitive | Stench |
| InChI | InChI=1S/C5H7N3S/c1-9-5-7-3-2-4(6)8-5/h2-3H,1H3,(H2,6,7,8) |
| InChIKey | HGGXLEAHOVIYKT-UHFFFAOYSA-N |
| SMILES | C1(SC)=NC=CC(N)=N1 |
Description and Uses
2-Methylsulfanylpyrimidin-4-amine is used for methoxylation to prepare pentafluorobenzyl derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H317-H318-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi,Xn |
| Risk Statements | 22-37/38-41-43 |
| Safety Statements | 26-36/37-39 |
| WGK Germany | 3 |
| HS Code | 2933599590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |








