A8417112
3-(3-Bromophenyl)propionic acid , 97% , 42287-90-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB83.20 | In Stock |
|
| 25G | RMB324.00 | In Stock |
|
| 100g | RMB1279.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 72-76 °C |
| Boiling point: | 336.3±17.0 °C(Predicted) |
| Density | 1.531±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.58±0.10(Predicted) |
| form | solid |
| color | Off-white to light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 2362753 |
| InChI | InChI=1S/C9H9BrO2/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6H,4-5H2,(H,11,12) |
| InChIKey | DWKWMFSWLCIMKI-UHFFFAOYSA-N |
| SMILES | C1(CCC(O)=O)=CC=CC(Br)=C1 |
| CAS DataBase Reference | 42287-90-1(CAS DataBase Reference) |
Description and Uses
It is used in the synthesis and characterization of monoisomeric 1,8,15,22-substituted (A3B and A2B2) phthalocyanines and phthalocyanine-fullerene dyads.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 34-22-36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |



