A8419912
2-Bromo-5-methylaniline , 97% , 53078-85-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB37.60 | In Stock |
|
| 25G | RMB105.60 | In Stock |
|
| 100G | RMB342.40 | In Stock |
|
| 500g | RMB1631.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 46°C |
| Boiling point: | 130°C/16mmHg(lit.) |
| Density | 1.486 g/mL at 25 °C |
| refractive index | n20/D 1.603 |
| Flash point: | 110 °C |
| storage temp. | 2-8°C |
| pka | 2.66±0.10(Predicted) |
| form | Solid |
| color | White to Orange to Green |
| InChI | InChI=1S/C7H8BrN/c1-5-2-3-6(8)7(9)4-5/h2-4H,9H2,1H3 |
| InChIKey | QTAQWOXSUFGGKH-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(C)=CC=C1Br |
| CAS DataBase Reference | 53078-85-6(CAS DataBase Reference) |
Description and Uses
2-Bromo-5-methylbenzenamine is an intermediate for synthesizing new indole anticancer drugs, antihypertensive drug reserpine, triptan drugs for treating migraine, indomethacin for treating rheumatism and rheumatoid arthritis, etc.
Safety
| Symbol(GHS) |   GHS07,GHS06 |
| Signal word | Warning |
| Hazard statements | H312-H315-H319-H331-H335-H302 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-20/21/22 |
| Safety Statements | 9-26-36/37-60 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| HS Code | 29214300 |
