A8424812
1-<WBR>Butyl-<WBR>4-<WBR>methylpyridinium tetrafluoroborate , 98% , 343952-33-0
Synonym(s):
1-Butyl-4-picolinium tetrafluoroborate;4MBPBF4
CAS NO.:343952-33-0
Empirical Formula: C10H16BF4N
Molecular Weight: 237.05
MDL number: MFCD03095460
EINECS: 629-543-7
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5g | RMB271.20 | In Stock |
|
| 25G | RMB716.80 | In Stock |
|
| 50g | RMB1279.20 | In Stock |
|
| 100G | RMB1999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 30℃ |
| Density | 1.20 g/mL at 20 °C(lit.) |
| refractive index | n |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| BRN | 9019838 |
| InChI | 1S/C10H16N.BF4/c1-3-4-7-11-8-5-10(2)6-9-11;2-1(3,4)5/h5-6,8-9H,3-4,7H2,1-2H3;/q+1;-1 |
| InChIKey | VISYYHYJMCAKAF-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.CCCC[n+]1ccc(C)cc1 |
Description and Uses
4MBPBF4 has been used in the preparation of the SWNT-polymer composite films to improve the dispersion of SWNTs and conductivity of the composites (SWNT= singlewalled carbon nanotubes). The use of 4MBPBF4 as a reaction media during derivatization of dimethyl sulfate with dibenzazepine, accelerates the rate of the reaction. It can also be used to modify carbon paste electrode, which leads to high sensitivity, selectivity and low detection limit for both potassium ferricyanide and dopamine by cyclic voltammetric technique.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H319 |
| Precautionary statements | P280a-P301+P312a-P305+P351+P338-P321-P332+P313-P501a |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/38 |
| Safety Statements | 26 |
| RIDADR | UN 1760 8/PG III |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2933.39.6190 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |







