A8439712
Xylometazoline HCl , ≥98.0%(HPLC) , 1218-35-5
Synonym(s):
2-(4-tert-Butyl-2,6-dimethylbenzyl)-2-imidazoline hydrochloride;Xylometazoline hydrochloride
CAS NO.:1218-35-5
Empirical Formula: C16H25ClN2
Molecular Weight: 280.84
MDL number: MFCD00238707
EINECS: 214-936-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB84.00 | In Stock |
|
| 5G | RMB219.20 | In Stock |
|
| 25G | RMB932.00 | In Stock |
|
| 100g | RMB3070.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-133 C |
| storage temp. | 2-8°C |
| solubility | Freely soluble in water, in ethanol (96 per cent) and in methanol. |
| form | Solid |
| color | Crystals |
| Merck | 14,10086 |
| Major Application | forensics and toxicology veterinary |
| InChI | InChI=1S/C16H24N2.ClH/c1-11-8-13(16(3,4)5)9-12(2)14(11)10-15-17-6-7-18-15;/h8-9H,6-7,10H2,1-5H3,(H,17,18);1H |
| InChIKey | YGWFCQYETHJKNX-UHFFFAOYSA-N |
| SMILES | C(C1NCCN=1)C1C(=CC(C(C)(C)C)=CC=1C)C.Cl |
| CAS DataBase Reference | 1218-35-5(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Imidazole, 2-[[4-(1,1-dimethylethyl)-2,6-dimethylphenyl]methyl]-4,5-dihydro-, monohydrochloride (1218-35-5) |
Description and Uses
anthelmintic
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | NJ2390000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LD50 orl-rat: 230 mg/kg KSRNAM 5,555,71 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |



