A8440112
(±)-Sodium 3-hydroxybutyrate , 98% , 150-83-4
Synonym(s):
(±)-3-Hydroxybutanoic acid sodium salt;(±)-3-Hydroxybutyric acid sodium salt
CAS NO.:150-83-4
Empirical Formula: C4H7NaO3
Molecular Weight: 126.09
MDL number: MFCD00016716
EINECS: 205-774-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB57.60 | In Stock |
|
| 25G | RMB180.00 | In Stock |
|
| 100G | RMB476.80 | In Stock |
|
| 500g | RMB1672.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-170 °C |
| storage temp. | 2-8°C |
| solubility | Methanol (Slightly, Sonicated), Water (Slightly) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | water: 1g/10 mL, clear, colorless |
| Sensitive | Hygroscopic |
| BRN | 4824866 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1 |
| InChIKey | NBPUSGBJDWCHKC-UHFFFAOYSA-M |
| SMILES | C(O)(C)CC([O-])=O.[Na+] |
| CAS DataBase Reference | 150-83-4(CAS DataBase Reference) |
Description and Uses
Optically active 3-hydroxybutyric acids are key intermediates of the biosynthesis and metabolism of fatty acids and exist widely in biological systems.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | 205-774-5 |
| F | 3-10 |
| HS Code | 29181990 |
| Storage Class | 11 - Combustible Solids |






