A8441012
(±)-Boc-α-phosphonoglycine trimethyl ester , ≥97% , 89524-98-1
Synonym(s):
(±)-Trimethyl-Boc-α-phosphonoglycinate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB89.60 | In Stock |
|
| 25g | RMB305.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 67-71°C |
| Boiling point: | 398.6±37.0 °C(Predicted) |
| Density | 1.204±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 9.63±0.46(Predicted) |
| form | Powder or Crystalline Powder |
| color | White to off-white |
| Water Solubility | Insoluble in water. |
| BRN | 4296364 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H20NO7P/c1-10(2,3)18-9(13)11-7(8(12)15-4)19(14,16-5)17-6/h7H,1-6H3,(H,11,13) |
| InChIKey | LJHAPRKTPAREGO-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(P(OC)(OC)=O)NC(OC(C)(C)C)=O |
Description and Uses
(+/-)-Boc-a-phosphonoglycine trimethyl ester is used as a Wittig-Horner reagent for preparing (Z)-Boc-protected dehydroamino acid derivatives.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






