A8445112
Ytterbium Trifluoromethanesulfonate , 97% , 54761-04-5
Synonym(s):
Trifluoromethanesulfonic acid ytterbium salt;Trifluoromethanesulfonic acid ytterbium(III) salt;Yb(OTf)3;Yb(TFA)3;Ytterbium(III) triflate
| Pack Size | Price | Stock | Quantity |
| 1G | RMB29.60 | In Stock |
|
| 5G | RMB96.00 | In Stock |
|
| 25G | RMB386.40 | In Stock |
|
| 100G | RMB1238.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Methanol |
| form | Powder |
| color | White to Off-White |
| Sensitive | Hygroscopic |
| Hydrolytic Sensitivity | 6: forms irreversible hydrate |
| Merck | 14,10106 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/3CHF3O3S.Yb/c3*2-1(3,4)8(5,6)7;/h3*(H,5,6,7);/q;;;+3/p-3 |
| InChIKey | AHZJKOKFZJYCLG-UHFFFAOYSA-K |
| SMILES | S(=O)(=O)(O[Yb](OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 54761-04-5(CAS DataBase Reference) |
Description and Uses
Ytterbium(III) Trifluoromethanesulfonate functions as a catalyst in the organic synthesis of heterocycles. Also functions as a Lewis acid in variety of organic reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| Hazard Note | Irritant/Hygroscopic |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 28469099 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
