A8445812
Ytterbium trifluoromethanesulfonate hydrate , 99.9%metalsbasis , 252976-51-5
CAS NO.:252976-51-5
Empirical Formula: C3H2F9O10S3Yb
Molecular Weight: 638.263
MDL number: MFCD03703499
| Pack Size | Price | Stock | Quantity |
| 1G | RMB111.20 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| 25G | RMB1118.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 118-122° |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Insoluble in water. |
| Stability: | hygroscopic |
| InChI | 1S/3CHF3O3S.H2O.Yb/c3*2-1(3,4)8(5,6)7;;/h3*(H,5,6,7);1H2;/q;;;;+3/p-3 |
| InChIKey | BUJKNFNMGRYZBV-UHFFFAOYSA-K |
| SMILES | [H]O[H].FC(F)(F)S(=O)(=O)O[Yb](OS(=O)(=O)C(F)(F)F)OS(=O)(=O)C(F)(F)F |
| CAS DataBase Reference | 252976-51-5 |
Description and Uses
Ytterbium(III) trifluoromethanesulfonate hydrate is used to promote glycosidation of glycosyl fluorides and as a catalyst in the preparation of pyridine and quinoline derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| HazardClass | 8 |
| HS Code | 28469000 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





