A8451412
Zinc methacrylate , 95% , 13189-00-9
Synonym(s):
Methacrylic acid zinc salt
CAS NO.：13189-00-9
Empirical Formula: C8H10O4Zn
Molecular Weight: 235.55
MDL number: MFCD00045887
EINECS: 236-144-8
| Pack Size | Price | Stock | Quantity |
| 100g | RMB103.20 | In Stock |
|
| 250G | RMB223.20 | In Stock |
|
| 500g | RMB399.20 | In Stock |
|
| 1KG | RMB687.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 229-232 °C(lit.) |
| Density | 1,4 g/cm3 |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| Specific Gravity | 1.48 |
| Appearance | White to off-white Solid |
| Water Solubility | 100mg/L at 20℃ |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| InChI | InChI=1S/2C4H6O2.Zn/c2*1-3(2)4(5)6;/h2*1H2,2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | PIMBTRGLTHJJRV-UHFFFAOYSA-L |
| SMILES | C(=O)(O[Zn]OC(=O)C(=C)C)C(=C)C |
| LogP | 0.3 at 25℃ |
| CAS DataBase Reference | 13189-00-9(CAS DataBase Reference) |
| EPA Substance Registry System | Zinc dimethacrylate (13189-00-9) |
Description and Uses
Zinc Methacrylate is used in preparation of two-component high- and low-temperature resistant Acrylate structural adhesive.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H315-H319-H334-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| TSCA | Yes |
