A8454312
Z-Lys-OH , 98% , 2212-75-1
Synonym(s):
Nα-(Carbobenzyloxy)-L -lysine;Nα-Cbz-L -lysine;Nα-Z-L -Lysine
CAS NO.:2212-75-1
Empirical Formula: C14H20N2O4
Molecular Weight: 280.32
MDL number: MFCD00038204
EINECS: 218-662-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5G | RMB80.00 | In Stock |
|
| 25G | RMB360.00 | In Stock |
|
| 100G | RMB1360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 226-231 °C (dec.)(lit.) |
| Boiling point: | 497.0±45.0 °C(Predicted) |
| alpha | -13 º (c=2 in 0.2N HCl) |
| Density | 1.206±0.06 g/cm3(Predicted) |
| refractive index | 1,512 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Methanol (Slightly), Water (Slightly) |
| pka | 3.90±0.21(Predicted) |
| form | Solid |
| color | White |
| optical activity | [α]20/D 13±2°, c = 2 in 0.2 M HCl |
| BRN | 2153826 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H20N2O4/c15-9-5-4-8-12(13(17)18)16-14(19)20-10-11-6-2-1-3-7-11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18)/t12-/m0/s1 |
| InChIKey | OJTJKAUNOLVMDX-LBPRGKRZSA-N |
| SMILES | NCCCC[C@H](NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 2212-75-1(CAS DataBase Reference) |
| EPA Substance Registry System | L-Lysine, N2-[(phenylmethoxy)carbonyl]- (2212-75-1) |
Description and Uses
N2-[(Phenylmethoxy)carbonyl]-L-lysine id used in the synthesis of hydroxamic acids and mycobacterium inhibitors.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |







