A8454412
Z-Pro-NH2 , 98% , 34079-31-7
Synonym(s):
Benzyloxycarbonyl-L -prolinamide;Carbobenzyloxy-L -prolinamide
CAS NO.:34079-31-7
Empirical Formula: C13H16N2O3
Molecular Weight: 248.28
MDL number: MFCD00020830
EINECS: 231-397-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB55.20 | In Stock |
|
| 5G | RMB66.40 | In Stock |
|
| 25G | RMB296.80 | In Stock |
|
| 100G | RMB724.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-95℃ |
| Boiling point: | 465.6±44.0 °C(Predicted) |
| Density | 1.263±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| pka | 15.95±0.20(Predicted) |
| form | Solid |
| color | White to Almost white |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H16N2O3/c14-12(16)11-7-4-8-15(11)13(17)18-9-10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,14,16)/t11-/m0/s1 |
| InChIKey | ZCGHEBMEQXMRQL-NSHDSACASA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CCC[C@H]1C(N)=O |
| CAS DataBase Reference | 34079-31-7(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







