A8456112
Z-Glu(OtBu)-OH , 99% , 3886-08-6
CAS NO.：3886-08-6
Empirical Formula: C17H23NO6
Molecular Weight: 337.37
MDL number: MFCD00038274
EINECS: 223-421-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB23.20 | In Stock |
|
| 5G | RMB31.20 | In Stock |
|
| 25G | RMB116.00 | In Stock |
|
| 100g | RMB456.00 | In Stock |
|
| 500g | RMB2191.20 | In Stock |
|
| 1kg | RMB4159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-87 °C |
| alpha | -14 º (c=2% in MeOH) |
| Boiling point: | 522.6±50.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 3.80±0.10(Predicted) |
| color | White to Almost white |
| optical activity | Consistent with structure |
| InChI | InChI=1S/C17H23NO6/c1-17(2,3)24-14(19)10-9-13(15(20)21)18-16(22)23-11-12-7-5-4-6-8-12/h4-8,13H,9-11H2,1-3H3,(H,18,22)(H,20,21)/t13-/m0/s1 |
| InChIKey | GLMODRZPPBZPPB-ZDUSSCGKSA-N |
| SMILES | C(O)(=O)[C@H](CCC(OC(C)(C)C)=O)NC(OCC1=CC=CC=C1)=O |
| CAS DataBase Reference | 3886-08-6(CAS DataBase Reference) |
Description and Uses
N-Cbz-L-Glutamic acid 5-tert-butyl ester is a white to pale yellow crystalline powder with good thermal and chemical stability. As an essential raw material for peptide synthesis and intermediate for drug development, N-Cbz-L-Glutamic acid 5-tert-butyl ester has broad application prospects in the fields of chemistry and biomedicine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 29242990 |
