A8457912
N-Benzyloxycarbonyl-L-tyrosine , 98% , 1164-16-5
Synonym(s):
N-Carbobenzyloxy-L -tyrosine;Z-L -Tyrosine
CAS NO.:1164-16-5
Empirical Formula: C17H17NO5
Molecular Weight: 315.32
MDL number: MFCD00037180
EINECS: 214-609-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB113.60 | In Stock |
|
| 100G | RMB337.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 57-60 °C(lit.) |
| Boiling point: | 454.88°C (rough estimate) |
| Density | 1.1781 (rough estimate) |
| refractive index | 10.0 ° (C=1, AcOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Acetic Acid (Sparingly), DMSO (Slightly), Methanol (Sparingly) |
| pka | 2.97±0.10(Predicted) |
| form | Solid |
| color | Off-White |
| optical activity | [α]22/D +11°, c = 1 in acetic acid |
| Water Solubility | 1.53g/L(25 ºC) |
| BRN | 2169918 |
| Major Application | peptide synthesis |
| InChI | 1S/C17H17NO5.H2O/c19-14-8-6-12(7-9-14)10-15(16(20)21)18-17(22)23-11-13-4-2-1-3-5-13;/h1-9,15,19H,10-11H2,(H,18,22)(H,20,21);1H2/t15-;/m0./s1 |
| InChIKey | BBPCQKGWAVVMSL-RSAXXLAASA-N |
| SMILES | O=C(N[C@H](C(O)=O)CC1=CC=C(O)C=C1)OCC2=CC=CC=C2 |
| CAS DataBase Reference | 1164-16-5(CAS DataBase Reference) |
Description and Uses
N-Cbz-L-tyrosine is an N-Cbz-protected form of L-Tyrosine (T899975). L-Tyrosine is an essential amino acid that exhibits in vitro antioxidant and antiradical activities. L-Tyrosine is used as a precursor to synthesize catecholamines (e.g. Norepinephrine HCl [N674500]) in human keratinocytes, and also for the synthesis of proteins and thyroid hormones.
Safety
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 22-24/25-36-26-45-36/37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






