A8468512
Zaltoprofen , ≥98% , 74711-43-6
CAS NO.：74711-43-6
Empirical Formula: C17H14O3S
Molecular Weight: 298.36
MDL number: MFCD00864323
EINECS: 277-973-5
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB72.00 | In Stock |
|
| 1G | RMB105.60 | In Stock |
|
| 5G | RMB158.40 | In Stock |
|
| 25g | RMB1097.60 | In Stock |
|
| 100g | RMB21159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-1310C |
| Boiling point: | 500.5±50.0 °C(Predicted) |
| Density | 1.329±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.21±0.10(Predicted) |
| color | Off-White to Pale Yellow |
| Merck | 14,10112 |
| InChI | InChI=1S/C17H14O3S/c1-10(17(19)20)11-6-7-15-12(8-11)9-14(18)13-4-2-3-5-16(13)21-15/h2-8,10H,9H2,1H3,(H,19,20) |
| InChIKey | MUXFZBHBYYYLTH-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C2SC3=CC=CC=C3C(CC2=C1)=O)(C)C(=O)O |
Description and Uses
Anti-inflammatory activity resides in (S)-enantiomer.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P330-P501 |
| RTECS | HQ2526700 |
| HS Code | 2934.99.4400 |
