A8471712
N-Carbobenzoxy-DL-alanine , ≥98% , 4132-86-9
Synonym(s):
N-Cbz-DL -alanine
CAS NO.：4132-86-9
Empirical Formula: C11H13NO4
Molecular Weight: 223.23
MDL number: MFCD00063125
EINECS: 223-953-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB25.60 | In Stock |
|
| 25G | RMB72.00 | In Stock |
|
| 100G | RMB275.20 | In Stock |
|
| 500g | RMB1485.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 112-113 °C(lit.) |
| Boiling point: | 364.51°C (rough estimate) |
| Density | 1.2446 (rough estimate) |
| refractive index | 1.4960 (estimate) |
| storage temp. | Sealed in dry,Store in freezer, under -20°C |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 4.00±0.10(Predicted) |
| color | White to Almost white |
| BRN | 6847292 |
| Major Application | peptide synthesis |
| InChI | 1S/C11H13NO4/c1-8(10(13)14)12-11(15)16-7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3,(H,12,15)(H,13,14) |
| InChIKey | TYRGLVWXHJRKMT-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)OCc1ccccc1)C(O)=O |
| CAS DataBase Reference | 4132-86-9(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
