A8472612
Zinc Dimethyldithiocarbamate , >97.0%(T) , 137-30-4
Synonym(s):
Dimethyldithiocarbamic acid zinc salt;Zinc dimethyldithiocarbamate;Ziram
CAS NO.:137-30-4
Empirical Formula: C6H12N2S4Zn1
Molecular Weight: 305.829
MDL number: MFCD00679340
EINECS: 205-288-3
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 248-257 °C(lit.) |
| Boiling point: | 335.83℃[at 101 325 Pa] |
| Density | 1.66 |
| vapor pressure | <1 x 10-6 Pa |
| storage temp. | APPROX 4°C |
| solubility | Insoluble[in water] |
| solubility | DMSO (Sparingly), Methanol (Sparingly) |
| form | Powder |
| Specific Gravity | 1.71 |
| color | White |
| Odor | odorless when pure |
| Water Solubility | 0.0065 g/100 mL |
| Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions |
| Merck | 14,10172 |
| BRN | 3707008 |
| Major Application | agriculture cleaning products cosmetics environmental food and beverages personal care |
| InChI | 1S/2C3H7NS2.Zn/c2*1-4(2)3(5)6;/h2*1-2H3,(H,5,6);/q;;+2/p-2 |
| InChIKey | DUBNHZYBDBBJHD-UHFFFAOYSA-L |
| SMILES | CN(C)C(=S)S[Zn]SC(=S)N(C)C |
| LogP | 1.65 at 20℃ |
| CAS DataBase Reference | 137-30-4(CAS DataBase Reference) |
| IARC | 3 (Vol. Sup 7, 53) 1991 |
| NIST Chemistry Reference | Zinc, bis(dimethylcarbamodithioato-s,s')-, (t-4)-(137-30-4) |
| EPA Substance Registry System | Ziram (137-30-4) |
Description and Uses
Ziram is a protective fungicide applied to foliage to control diseases on pome fruit, stone fruit, nuts, vines, vegetables and ornamentals. It is used to control scab in apples and pears and Monilia, Alternaria, Septoria, peach leaf curl, shot hole, rusts, black rot and anthracnose. It is also used as a wildlife repellent, smeared as a paste onto tree trunks or sprayed onto ornamentals, dormant fruit trees and other crops.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302-H317-H318-H330-H335-H373-H410 |
| Precautionary statements | P273-P280-P301+P312-P304+P340+P310-P305+P351+P338-P314 |
| target organs | Liver,Blood, Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,N |
| Risk Statements | 22-26-37-41-43-48/22-50/53 |
| Safety Statements | 22-26-28-36/37/39-45-60-61 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | ZH0525000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29302000 |
| Storage Class | 6.1B - Non-combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Eye Dam. 1 Skin Sens. 1 STOT RE 2 Oral STOT SE 3 |
| Hazardous Substances Data | 137-30-4(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 1.4 g/kg (Hodge) |
| Limited Quantities | 100ml (liquid) or 0.5 Kg (solid) |
| Excepted Quantities | Max Inner Pack (1g or 1ml) and Max Outer Pack (500g or 500ml) |










