A8473312
Zinc(II) Tetraphenylporphyrin , >98.0%(HPLC) , 14074-80-7
Synonym(s):
meso-Tetraphenylporphine;TPP;Zinc TPP
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB119.20 | In Stock |
|
| 250mg | RMB229.60 | In Stock |
|
| 1G | RMB618.40 | In Stock |
|
| 5G | RMB2559.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >350 °C (decomp) |
| storage temp. | −20°C |
| form | crystal |
| color | purple |
| Water Solubility | Insoluble in water. |
| λmax | 586nm(CH2Cl2)(lit.) |
| InChIKey | XPVVGUHKLPZAEN-DAJBKUBHSA-N |
| SMILES | N12[Zn]N3C4C=CC3=C(C3C=CC(N=3)=C(C3=CC=CC=C3)C1=CC=C2C(C1=CC=CC=C1)=C1C=CC(C=4C2=CC=CC=C2)=N1)C1=CC=CC=C1 |c:7,14,41,t:36| |
| EPA Substance Registry System | Zinc, [5,10,15,20-tetraphenyl-21H,23H-porphinato(2-)-.kappa.N21,.kappa.N22,.kappa.N23,.kappa.N24]-, (SP-4-1)- (14074-80-7) |
Description and Uses
A porphyrin used in light emitting diodes. It has valuable biological applications in molecular biology, fluoroimmunoassay and new pharmaceutical developments.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29339900 |
