A8477532
Eriochrome black T , Solubbing in tritenol, hard water indicator , 1787-61-7
Synonym(s):
Chrome black T, 2-Hydroxy-1-(1-hydroxy-2-naphthylazo)-6-nitronaphthalene-4-sulfonic acid sodium salt;Eriochrome black T (C.I. 14645);Mordant Black 11
CAS NO.:1787-61-7
Empirical Formula: C20H12N3NaO7S
Molecular Weight: 461.38
MDL number: MFCD00003935
EINECS: 217-250-3
| Pack Size | Price | Stock | Quantity |
| 500ML | RMB375.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.109 g/mL at 25 °C |
| bulk density | 400-600kg/m3 |
| Flash point: | 185 °C |
| storage temp. | room temp |
| solubility | 50g/l |
| Colour Index | 14645 |
| form | Powder/Solid |
| pka | pK1:6.3;pK2:11.55 (25°C) |
| Specific Gravity | 1.109 |
| color | Brownish-black to black |
| PH | 3.7 (10g/l, H2O, 20℃) |
| Odor | Odorless |
| Water Solubility | 50 g/L (20 ºC) |
| λmax | 612-616 nm (buffer pH 10.0) |
| Merck | 14,3667 |
| BRN | 4121162 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C20H13N3O7S.Na/c24-17-10-18(31(28,29)30)15-9-12(23(26)27)6-7-14(15)19(17)22-21-16-8-5-11-3-1-2-4-13(11)20(16)25;/h1-10,24-25H,(H,28,29,30);/q;+1/p-1/b22-21+; |
| InChIKey | AMMWFYKTZVIRFN-QUABFQRHSA-M |
| SMILES | [Na+].Oc1cc(c2cc(ccc2c1\N=N\c3ccc4ccccc4c3O)[N+]([O-])=O)S([O-])(=O)=O |
| CAS DataBase Reference | 1787-61-7(CAS DataBase Reference) |
| EPA Substance Registry System | C.I. Mordant Black 11, monosodium salt (1787-61-7) |
Description and Uses
Eriochrome? Black T has been used to determine the concentration of Ca2+ using complexometric titration method.
Safety
| Symbol(GHS) | ![]() GHS09 |
| Signal word | Danger |
| Hazard statements | H411 |
| Precautionary statements | P273-P391-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36-36/37/38-36/38 |
| Safety Statements | 39-26-37/39-24/25 |
| RIDADR | 3077 |
| WGK Germany | 2 |
| RTECS | QK2197000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 32041900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 |
| Toxicity | LD50 oral in rat: 17590mg/kg |





