A8480512
(Z)-tert-Butyl 2-(((1-(2-aminothiazol-4-yl)-2-(benzo[d]thiazol-2-ylthio)-2-oxoethylidene)amino)oxy)-2-methylpropanoate , 96% , 89604-92-2
CAS NO.:89604-92-2
Empirical Formula: C20H22N4O4S3
Molecular Weight: 478.61
MDL number: MFCD00071548
EINECS: 419-040-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB60.00 | In Stock |
|
| 5g | RMB95.20 | In Stock |
|
| 25g | RMB377.60 | In Stock |
|
| 100g | RMB1147.20 | In Stock |
|
| 500g | RMB12239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 138-140°C |
| Boiling point: | 621.6±61.0 °C(Predicted) |
| Density | 1.41±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform, Methanol |
| form | Solid |
| pka | 0.83±0.10(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C20H22N4O4S3/c1-19(2,3)27-16(26)20(4,5)28-24-14(12-10-29-17(21)22-12)15(25)31-18-23-11-8-6-7-9-13(11)30-18/h6-10H,1-5H3,(H2,21,22)/b24-14- |
| InChIKey | RCZJVHXVCSKDKB-OYKKKHCWSA-N |
| SMILES | C(OC(C)(C)C)(=O)C(O/N=C(/C1=CSC(N)=N1)\C(SC1=NC2=CC=CC=C2S1)=O)(C)C |
| CAS DataBase Reference | 89604-92-2(CAS DataBase Reference) |
Description and Uses
An intermediate for the preparation of cephalosporin derivatives.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H317 |
| Precautionary statements | P501-P261-P272-P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P333+P313 |
| Risk Statements | 53 |
| Safety Statements | 61 |

![(Z)-tert-Butyl 2-(((1-(2-aminothiazol-4-yl)-2-(benzo[d]thiazol-2-ylthio)-2-oxoethylidene)amino)oxy)-2-methylpropanoate](https://img.chemicalbook.com/CAS/GIF/89604-92-2.gif)




![1-[[(6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)[(1-carboxy-1-methylethoxy)imino]acetyl]amino]-2-carboxy-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl]pyridinium chloride monohydrochloride](https://img.chemicalbook.com/CAS/GIF/73547-70-3.gif)
