A8495132
1H-indole-2,3-dicarboxylic acid , 97% , 54781-93-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB244.00 | In Stock |
|
| 1G | RMB608.00 | In Stock |
|
| 5G | RMB2455.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 113-114 °C (lit.) |
| Boiling point: | 375.46°C (rough estimate) |
| Density | 1.2697 (rough estimate) |
| refractive index | 1.5560 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.39±0.30(Predicted) |
| form | Powder |
| color | Yellow |
| InChI | InChI=1S/C12H11NO4/c1-16-11(14)9-7-5-3-4-6-8(7)13-10(9)12(15)17-2/h3-6,13H,1-2H3 |
| InChIKey | JNRXSMOJWKDVHC-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C(C(OC)=O)=C1C(OC)=O |
| CAS DataBase Reference | 54781-93-0(CAS DataBase Reference) |
Description and Uses
Reactant for preparation of:
- Indole-indolone scaffolds
- Chemiluminescent agents
- Antihypertensive agents
- Inhibitors of blood platelet aggregation and inotropic agents
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29339980 |
| Storage Class | 11 - Combustible Solids |







