A8502032
(2<I>S</I>,3<I>R</I>)-(+)-<I>N</I>-Z-6-oxo-2,3-diphenylmorpholine , ≥98.0%(HPLC) , 105228-46-4
Synonym(s):
Benzyl (2S,3R)-(+)-6-oxo-2,3-diphenyl-4-morpholinecarboxylate
| Pack Size | Price | Stock | Quantity |
| 5G | RMB1070.40 | In Stock |
|
| 10G | RMB2116.80 | In Stock |
|
| 25G | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 205-207 °C(lit.) |
| alpha | 66 º (c=5.5 in methylene chloride) |
| Boiling point: | 583.5±50.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | -3.33±0.60(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]25/D +66°, c = 5.5 in methylene chloride |
| InChI | InChI=1S/C24H21NO4/c26-21-16-25(24(27)28-17-18-10-4-1-5-11-18)22(19-12-6-2-7-13-19)23(29-21)20-14-8-3-9-15-20/h1-15,22-23H,16-17H2/t22-,23+/m1/s1 |
| InChIKey | HECRUWTZAMPQOS-PKTZIBPZSA-N |
| SMILES | N1(C(OCC2=CC=CC=C2)=O)CC(=O)O[C@@H](C2=CC=CC=C2)[C@H]1C1=CC=CC=C1 |
Description and Uses
(2S,3R)-(+)-N-Z-6-oxo-2,3-diphenylmorpholine can be used as a starting material for the synthesis of:
- α-Amino-β-silyloxy-ester, a key intermediate for the preparation of antimalarial drug quinine and its analogs.
- R, R-Formylglycine dimethylacetal, a key intermediate for the preparation of tuberculostatic compound capreomycin IB.
- 2R,5R,6S-2-(Methoxycarbonylmethyl)-5,6-diphenylmorpholine hydrochloride, a key intermediate for the preparation of an antibiotic (+)-negamycin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





