A8512132
Methyl 2-(chlorosulfonyl)benzoate , 94% , 26638-43-7
CAS NO.：26638-43-7
Empirical Formula: C8H7ClO4S
Molecular Weight: 234.66
MDL number: MFCD00009797
EINECS: 631-087-9
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB27.20 | In Stock |
|
| 1G | RMB65.60 | In Stock |
|
| 5g | RMB204.00 | In Stock |
|
| 25g | RMB758.40 | In Stock |
|
| 100g | RMB3119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 62-63 °C |
| Boiling point: | 344.8±25.0 °C(Predicted) |
| Density | 1.4452 (estimate) |
| storage temp. | Inert atmosphere,2-8°C |
| form | Crystalline Powder or Chunks |
| color | White to beige or pink |
| Water Solubility | reacts |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C8H7ClO4S/c1-13-8(10)6-4-2-3-5-7(6)14(9,11)12/h2-5H,1H3 |
| InChIKey | HUNUAFNLLYVTQD-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C1=CC=CC=C1S(Cl)(=O)=O |
| CAS DataBase Reference | 26638-43-7(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 2-(chlorosulfonyl)-, methyl ester (26638-43-7) |
Description and Uses
Methyl 2-(chlorosulfonyl)benzoate can be used as intermediates in pharmaceuticals, saccharin, dyes, & pigments.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | 34-29-14 |
| Safety Statements | 45-36/37/39-30-26-22 |
| RIDADR | 3261 |
| Hazard Note | Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29163990 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
