A8521332
(R)-(-)-α-Methoxy-α-(trifluoromethyl)phenylacetyl chloride , Used for GC derivatives , 39637-99-5
Synonym(s):
(R)-(−)-MTPA-Cl;Mosher’s acid chloride
CAS NO.:39637-99-5
Empirical Formula: C10H8ClF3O2
Molecular Weight: 252.62
MDL number: MFCD00067105
EINECS: 621-758-4
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB2079.20 | In Stock |
|
| 500MG | RMB7199.20 | In Stock |
|
| 1G | RMB12719.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | D25 -10.0± 0.1° (neat, l = 1) |
| Boiling point: | 213-214 °C(lit.) |
| Density | 1.35 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 194 °F |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Liquid |
| color | Clear colorless to light yellow |
| Specific Gravity | 1.353 |
| optical activity | [α]20/D 137±2°, c = 6.4% in carbon tetrachloride |
| Water Solubility | Sparingly miscible with water. |
| Sensitive | Moisture Sensitive |
| Merck | 14,6280 |
| BRN | 3591565 |
| InChI | 1S/C10H8ClF3O2/c1-16-9(8(11)15,10(12,13)14)7-5-3-2-4-6-7/h2-6H,1H3/t9-/m0/s1 |
| InChIKey | PAORVUMOXXAMPL-VIFPVBQESA-N |
| SMILES | CO[C@](C(Cl)=O)(c1ccccc1)C(F)(F)F |
| CAS DataBase Reference | 39637-99-5(CAS DataBase Reference) |
Description and Uses
(R)-(-)-α-Methoxy-α-(trifluoromethyl)phenylacetyl chloride is used as a chiral acylating reagent, which is used in the resolution of amino acid enantiomers like 2,5-dimethoxy-4-methylamphetamine. It is also suitable for the determination of the optical composition of compounds extracted from biological fluids.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P301+P330+P331-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Corrosive/Freeze |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29189900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |



