Ochratoxin A-13C20 , 10μg/mLinacetonitrile , 303-47-9
Synonym(s):
N-[(3R)-(5-Chloro-8-hydroxy-3-methyl-1-oxo-7-isochromanyl)carbonyl]-L -phenylalanine;N-[(3R)-(5-Chloro-8-hydroxy-3-methyl-1-oxo-7-isochromanyl)carbonyl]-L-phenylalanine;Ochratoxin A - CAS 303-47-9 - Calbiochem;OTA
CAS NO.:303-47-9
Empirical Formula: C20H18ClNO6
Molecular Weight: 403.81
MDL number: MFCD00078079
EINECS: 206-143-7
PRODUCT Properties
| Melting point: | 169°C |
| alpha | D -118° (c = 1.1 in CHCl3) |
| Boiling point: | 632.4±55.0 °C(Predicted) |
| Density | 1.2459 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | ethanol: soluble |
| form | powder |
| pka | 3.29±0.10(Predicted) |
| color | White to off-white |
| biological source | Aspergillus ochraceus |
| Merck | 13,6772 |
| BRN | 8169012 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C20H18ClNO6/c1-10-7-12-14(21)9-13(17(23)16(12)20(27)28-10)18(24)22-15(19(25)26)8-11-5-3-2-4-6-11/h2-6,9-10,15,23H,7-8H2,1H3,(H,22,24)(H,25,26)/t10-,15+/m1/s1 |
| InChIKey | RWQKHEORZBHNRI-BMIGLBTASA-N |
| SMILES | C[C@@H]1Cc2c(Cl)cc(c(O)c2C(=O)O1)C(=O)N[C@@H](Cc3ccccc3)C(O)=O |
| IARC | 2B (Vol. Sup 7, 56) 1993 |
| EPA Substance Registry System | Ochratoxin A (303-47-9) |
Description and Uses
Ochratoxin A is a chlorinated benzopyran coupled to phenylalanine, produced by several Aspergillus and Penicillium sp. associated with food spoilage. Ochratoxins are widely distributed in the environment and are known to be nephrotoxic, teratogenic and possibly carcinogenic. Ochratoxin A may act by inducing DNA strand breaks, sister chromatid exchanges, DNA adduct formation, or reactive oxygen but the mechanism of action as a toxin is not yet resolved. At the molecular level, ochratoxin A specifically inhibits NK cell activity, increases growth of transplantable tumour cells in mice, increases apoptosis, activates c-Jun N terminal kinase in human kidney epithelial cells, and blocks metaphase/anaphase transition. It also inhibits plasminogen activator inhibitor-2 production by human blood mononuclear cells.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H350-H360 |
| Precautionary statements | P202-P260-P264-P280-P302+P352+P310-P304+P340+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,T,Xn,F |
| Risk Statements | 45-46-61-26/27/28-36-20/21/22-11-40-28-39/23/24/25-23/24/25-65-48/23/24/25-36/38 |
| Safety Statements | 53-22-36/37/39-45-36-26-16-36/37-28-62 |
| RIDADR | UN 3462 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | AY4375000 |
| F | 10 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 29322985 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 303-47-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in rats: 20-22 mg/kg (Purchase, Theron) |






