A8547432
Potassium tartrate , 99% , 921-53-9
Synonym(s):
Potassium bitartrate;Potassium hydrogen tartrate;Tartaric acid monopotassium salt;Potassium hydrogen L -tartrate;L -(+)-Tartaric acid monopotassium salt
CAS NO.:921-53-9
Empirical Formula: C4H4K2O6
Molecular Weight: 226.27
MDL number: MFCD00013065
EINECS: 213-067-8
| Pack Size | Price | Stock | Quantity |
| 100G | RMB23.20 | In Stock |
|
| 500G | RMB84.00 | In Stock |
|
| 2.5kg | RMB336.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Density | 1.954 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 25℃ |
| Flash point: | 200-220°C |
| Decomposition | 200-220 ºC |
| Stability: | Stable. |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | InChI=1S/C4H6O6.2K/c5-1(3(7)8)2(6)4(9)10;;/h1-2,5-6H,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | AVTYONGGKAJVTE-UHFFFAOYSA-L |
| SMILES | [K+].[K+].C([O-])(=O)C(C(C([O-])=O)O)O |
| LogP | -1.426 (est) |
| CAS DataBase Reference | 921-53-9(CAS DataBase Reference) |
| EPA Substance Registry System | Butanedioic acid, 2,3-dihydroxy- (2R,3R)-, dipotassium salt (921-53-9) |
Description and Uses
Potassium tartrate, dipotassium tartrate or argol has formula K2C4H4O6. It is the potassium salt of tartaric acid. It is often confused with potassium bitartrate, also known as cream of tartar. As a food additive, it shares the E number E336 with potassium bitartrate.
Manufacture of potassium salts, medicine (cathartic), lab reagent.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 1 |
| RTECS | WW8223000 |
| TSCA | TSCA listed |
| HS Code | 29181300 |




