A8564132
(S)-(−)-2-(Boc-amino)-1,4-butanediol , ≥97% , 128427-10-1
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB75.20 | In Stock |
|
| 1G | RMB196.00 | In Stock |
|
| 5G | RMB618.40 | In Stock |
|
| 25G | RMB4390.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-69 °C(lit.) |
| alpha | -8 º (c=1 in chloroform) |
| Boiling point: | 365.0±32.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Crystalline Powder |
| pka | 11.81±0.46(Predicted) |
| color | White |
| optical activity | [α]20/D 8°, c = 1 in chloroform |
| InChI | 1S/C9H19NO4/c1-9(2,3)14-8(13)10-7(6-12)4-5-11/h7,11-12H,4-6H2,1-3H3,(H,10,13)/t7-/m0/s1 |
| InChIKey | KLRRFBSWOIUAHZ-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)CCO |
Description and Uses
(S)-(?)-2-(Boc-amino)-1,4-butanediol can be used as a reactant to synthesize:
- Thiourea-based organocatalysts for asymmetric Michael addition reactions of nitroalkenes to α-nitrocyclohexanone.
- Bis-copper (II) complex based catalysts for enantioselective Michael reactions.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29051990 |
| Storage Class | 11 - Combustible Solids |
