A8568932
Sterigmatocystin--13C18 , 25μg/mLinacetonitrile , 10048-13-2
Synonym(s):
3a,12c-Dihydro-8-hydroxy-6-methoxy-7H-furol[3′,2′:4,5]furo[2,3-c]xanthen-7-one;3a,12c-Dihydro-8-hydroxy-6-methoxy-7H-furol[3′,2′:4,5]furo[2,3-c]xanthen-7-one
CAS NO.:10048-13-2
Empirical Formula: C18H12O6
Molecular Weight: 324.28
MDL number: MFCD32182631
EINECS: 233-158-6
| Pack Size | Price | Stock | Quantity |
| 1.2ML | RMB10399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 249-251℃ |
| Boiling point: | 382.63°C (rough estimate) |
| Density | 1.2842 (rough estimate) |
| refractive index | 1.4800 (estimate) |
| Flash point: | 6℃ |
| storage temp. | 2-8°C |
| solubility | Acetone: 5 mg/ml |
| form | powder |
| pka | 6.92±0.20(Predicted) |
| color | yellow |
| BRN | 53259 |
| InChI | 1S/C18H12O6/c1-21-11-7-12-13(8-5-6-22-18(8)24-12)17-15(11)16(20)14-9(19)3-2-4-10(14)23-17/h2-8,18-19H,1H3 |
| InChIKey | UTSVPXMQSFGQTM-UHFFFAOYSA-N |
| SMILES | COc1cc2OC3OC=CC3c2c4Oc5cccc(O)c5C(=O)c14 |
| LogP | 3.169 (est) |
| CAS DataBase Reference | 10048-13-2 |
| IARC | 2B (Vol. 10, Sup 7) 1987 |
| EPA Substance Registry System | Sterigmatocystin (10048-13-2) |
Description and Uses
Sterigmatocystin is a mycotoxin that has been found in Aspergillus. It is lethal to rats (LD50 = 60 mg/kg) and chick embryos (LD50s = 5-7 μg/embryo). Sterigmatocystin (100 and 1,000 ppb in drinking water) induces gastritis, as well as intestinal polyp formation and metaplasia in aged Mongolian gerbils. It induces formation of lung and liver adenomas and malignant lymphomas in newborn mice.
Sterigmatocystin is a carcinogenic mycotoxin that is struturally related to Aflatoxin. Sterigmatocystin has been shown to inhibit RNA synthesis in rat liver nuclei.
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H351 |
| Precautionary statements | P201-P301+P310+P330 |
| Hazard Codes | T,Xn,F |
| Risk Statements | 25-40-36-20/21/22-11 |
| Safety Statements | 36/37-45-16 |
| RIDADR | UN 3462 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | LV1750000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29329990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Carc. 2 |
| Hazardous Substances Data | 10048-13-2(Hazardous Substances Data) |








