A8573432
(S)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-bi-2-naphthol , 98% , 849939-13-5
Synonym(s):
(1S)-3,3′-Bis[3,5-bis(trifluoromethyl)phenyl]1,1′-binaphthalene-2,2′-diol
CAS NO.:849939-13-5
Empirical Formula: C36H18F12O2
Molecular Weight: 710.51
MDL number: MFCD08689862
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB413.60 | In Stock |
|
| 500mg | RMB1439.20 | In Stock |
|
| 1g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 215-219 °C |
| Boiling point: | 574.7±50.0 °C(Predicted) |
| Density | 1.466±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | (Powder or Crystals or Solid or Chunks) |
| pka | 7.62±0.50(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]22/D -56°, c = 1 in chloroform |
| InChIKey | PGXMYJSTCAQJBY-UHFFFAOYSA-N |
| SMILES | Oc1c(cc2ccccc2c1-c3c(O)c(cc4ccccc34)-c5cc(cc(c5)C(F)(F)F)C(F)(F)F)-c6cc(cc(c6)C(F)(F)F)C(F)(F)F |
Description and Uses
(S)-(-)-3-3′-Bis(3,5-bis(trifluoromethyl)phenyl)-1,1′-bi-2-naphthol reacts with tin(IV) chloride to form a Sn(IV) aryloxide Lewis acid, which can catalyze asymmetric Diels-Alder reactions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2809200000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 |

![(S)-3,3'-Bis[3,5-bis(trifluoromethyl)phenyl]-1,1'-bi-2-naphthol](https://img.chemicalbook.com/CAS/GIF/849939-13-5.gif)

![(11bS)-4-Hydroxy-2,6-bis(4-nitrophenyl)dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine4-oxide](https://img.chemicalbook.com/CAS/GIF/878111-16-1.gif)

![(S)-3,3'-Bis[4-(2-naphthalenyl)phenyl]-1,1'-binaphthyl-2,2'-diylHydrogenphosphate](https://img.chemicalbook.com/CAS/20210111/GIF/871130-15-3.gif)
![(S)-3,3''-Bis[4-(2-naphthalenyl)phenyl]-[,1''-binaphthalene]-2,2''-diol](https://img.chemicalbook.com/CAS/20200515/GIF/309934-87-0.gif)
