A8573732
Sodium D-Pantothenate , 99% , 867-81-2
CAS NO.：867-81-2
Empirical Formula: C9H16NNaO5
Molecular Weight: 241.22
MDL number: MFCD00002767
EINECS: 212-768-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5G | RMB62.40 | In Stock |
|
| 25G | RMB128.00 | In Stock |
|
| 100G | RMB358.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 171-178 °C(lit.) |
| alpha | D25 +27.1° (c = 2) |
| refractive index | 27 ° (C=5, H2O) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Water (Slightly) |
| form | Solid |
| color | White to Off-White |
| optical activity | 24.2°(C=0.01g/mI, H2O, 20°C, 589nm) |
| Stability: | Hygroscopic |
| InChI | InChI=1/C9H17NO5.Na/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13;/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13);/q;+1/p-1/t7-;/s3 |
| InChIKey | GQTHJBOWLPZUOI-WMASNCOMNA-M |
| SMILES | [C@H](O)(C(=O)NCCC([O-])=O)C(C)(C)CO.[Na+] |&1:0,r| |
| LogP | -0.849 (est) |
| CAS DataBase Reference | 867-81-2(CAS DataBase Reference) |
| EPA Substance Registry System | .beta.-Alanine, N-[(2R)-2,4-dihydroxy-3,3-dimethyl-1-oxobutyl]-, monosodium salt (867-81-2) |
Description and Uses
D-Pantothenic acid sodium (Sodium pantothenate) is an essential trace nutrient that functions as the obligate precursor of coenzyme A (CoA). D-Pantothenic acid sodium plays key roles in myriad biological processes, including many that regulate carbohydrate, lipid, protein, and nucleic acid metabolism[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H315 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-48-41-37/38-20/21/22 |
| Safety Statements | 26-36-45-36/37/39-22-24/25 |
| HS Code | 29241990 |
| Hazardous Substances Data | 867-81-2(Hazardous Substances Data) |
