A8575732
(S)-(-)-1,2,3,4-tetrahydro-3-isoquinolinecarboxylate p-toluenesulfonic acid salt , ≥97.0% , 77497-97-3
CAS NO.：77497-97-3
Empirical Formula: C17H17NO2.C7H8O3S
Molecular Weight: 439.53
MDL number: MFCD03419265
EINECS: 406-960-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB218.40 | In Stock |
|
| 25G | RMB596.00 | In Stock |
|
| 100G | RMB1660.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 145-150°C |
| storage temp. | Inert atmosphere,Room Temperature |
| InChI | 1S/C17H17NO2.C7H8O3S/c19-17(20-12-13-6-2-1-3-7-13)16-10-14-8-4-5-9-15(14)11-18-16;1-6-2-4-7(5-3-6)11(8,9)10/h1-9,16,18H,10-12H2;2-5H,1H3,(H,8,9,10)/t16-;/m0./s1 |
| InChIKey | PSMBIFNNFMRIMV-NTISSMGPSA-N |
| SMILES | Cc1ccc(cc1)S(O)(=O)=O.O=C(OCc2ccccc2)[C@@H]3Cc4ccccc4CN3 |
| CAS DataBase Reference | 77497-97-3(CAS DataBase Reference) |
Description and Uses
Quinapril intermediate
Safety
| Symbol(GHS) |  GHS09 |
| Signal word | Danger |
| Hazard statements | H411 |
| Precautionary statements | P273 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | N |
| Risk Statements | 51/53 |
| Safety Statements | 61 |
| RIDADR | UN 3077 |
| WGK Germany | 2 |
| HazardClass | 9 |
| HS Code | 2933499090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Chronic 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
