A8577332
7-(Trifluoromethyl)-4-quinolinol , 96% , 322-97-4
Synonym(s):
7-(Trifluoromethyl)-4-quinolinol
CAS NO.：322-97-4
Empirical Formula: C10H6F3NO
Molecular Weight: 213.16
MDL number: MFCD00006779
EINECS: 206-298-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB36.00 | In Stock |
|
| 1G | RMB89.60 | In Stock |
|
| 5g | RMB359.20 | In Stock |
|
| 25g | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 266-269 °C(lit.) |
| Boiling point: | 311.9±37.0 °C(Predicted) |
| Density | 1.3581 (estimate) |
| storage temp. | 2-8°C |
| pka | 3.79±0.40(Predicted) |
| form | Powder |
| color | Light grayish to beige |
| InChI | 1S/C10H6F3NO/c11-10(12,13)6-1-2-7-8(5-6)14-4-3-9(7)15/h1-5H,(H,14,15) |
| InChIKey | OWPLFJSQLPTCHS-UHFFFAOYSA-N |
| SMILES | Oc1ccnc2cc(ccc12)C(F)(F)F |
| CAS DataBase Reference | 322-97-4(CAS DataBase Reference) |
Description and Uses
4-Hydroxy-7-(trifluoromethyl)quinoline was used in the synthesis of 4[[7-(trifluoromethyl)quinolin-4-yl]oxy]pthalonitrile.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29334990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
