PRODUCT Properties
| Melting point: | 184 °C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in water, practically insoluble in ethanol (96 per cent). It dissolves in dilute hydrochloric acid. |
| form | Powder |
| color | White to off-white |
| Odor | Odorless |
| Water Solubility | Slightly soluble in water. |
| Merck | 14,5663 |
| InChI | InChI=1S/C6H8O7.Mg.2H/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;; |
| InChIKey | RCMPDQYZJPTTFC-UHFFFAOYSA-N |
| SMILES | C(O)(C(=O)O)(CC(=O)O)CC(=O)O.[Mg] |
| LogP | -1.721 (est) |
| CAS DataBase Reference | 3344-18-1(CAS DataBase Reference) |
Description and Uses
Laxative .
