A8593532
2,4,7,9-Tetramethyl-5-decyne-4,7-diol (DL- and meso- mixture) , 98% , 126-86-3
CAS NO.:126-86-3
Empirical Formula: C14H26O2
Molecular Weight: 226.35
MDL number: MFCD00008942
EINECS: 204-809-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB79.20 | In Stock |
|
| 500G | RMB319.20 | In Stock |
|
| 2.5KG | RMB799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-44 °C(lit.) |
| Boiling point: | 255 °C(lit.) |
| Density | 0,89 g/cm3 |
| vapor pressure | 0.66Pa at 20℃ |
| refractive index | 1.4560 (estimate) |
| Flash point: | >230 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.92±0.29(Predicted) |
| color | White to Off-White |
| Water Solubility | 1.7g/L at 20℃ |
| BRN | 1724053 |
| Hydrophilic-Lipophilic Balance (HLB) | 4 |
| Cosmetics Ingredients Functions | CLEANSING SURFACTANT - CLEANSING |
| InChI | 1S/C14H26O2/c1-11(2)9-13(5,15)7-8-14(6,16)10-12(3)4/h11-12,15-16H,9-10H2,1-6H3 |
| InChIKey | DCAZNTOSTOZBEI-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(O)C#CC(C)(O)CC(C)C |
| LogP | 2.8 at 22℃ |
| CAS DataBase Reference | 126-86-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,7,9-Tetramethyl-5-decyne-4,7-diol (126-86-3) |
Description and Uses
2,4,7,9-Tetramethyl-5-decyne-4,7-diol is an acetylene glycol derivative used in water-based coatings and has both antifoaming and surfactant properties. It is highly toxic and have been found in acrylic adhesives used for food packaging multilayers manufacturing.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H317-H318-H412 |
| Precautionary statements | P261-P272-P273-P280-P302+P352-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36-52/53 |
| Safety Statements | 26-37/39-61-39-37/29 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| PackingGroup | III |
| HS Code | 29053990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Aquatic Chronic 3 Eye Dam. 1 Skin Sens. 1 |
| Hazardous Substances Data | 126-86-3(Hazardous Substances Data) |





