A9015127
Potassium benzyltrifluoroborate , 95% , 329976-73-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB55.20 | In Stock |
|
| 1G | RMB159.20 | In Stock |
|
| 5G | RMB559.20 | In Stock |
|
| 25g | RMB2042.40 | In Stock |
|
| 100g | RMB6799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >300 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder |
| color | White |
| InChI | 1S/C7H7BF3.K/c9-8(10,11)6-7-4-2-1-3-5-7;/h1-5H,6H2;/q-1;+1 |
| InChIKey | ANAJBFAVJLMYCY-UHFFFAOYSA-N |
| SMILES | [K+].F[B-](F)(F)Cc1ccccc1 |
Description and Uses
Organotrifluoroborate involved in:• ;Oxidation1,2• ;Ritter-type amidation with nitriles3• ;Photo-allylation / photo-benzylation of carbonyl compounds4• ;Stereoselective nucleophilic addition5• ;Suzuki cross-coupling6Organotrifluoroborates as versatile and stable boronic acid surrogates
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
