BD0014956
2-(Diethylamino)ethylacrylate , 95%(stabilizedwith25ppmMEHQ) , 2426-54-2
Synonym(s):
(N ,N -Diethylamino)ethyl acrylate;[2-(Acryloyloxy)ethyl]diethylamine
CAS NO.:2426-54-2
Empirical Formula: C9H17NO2
Molecular Weight: 171.24
MDL number: MFCD00042882
EINECS: 219-378-5
| Pack Size | Price | Stock | Quantity |
| 25g | RMB53.60 | In Stock |
|
| 100g | RMB176.80 | In Stock |
|
| 500g | RMB617.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -60°C |
| Boiling point: | 199 °C(lit.) |
| Density | 0.922 g/mL at 25 °C(lit.) |
| vapor pressure | 0.77 psi ( 20 °C) |
| refractive index | n |
| Flash point: | 165 °F |
| pka | 9.20±0.25(Predicted) |
| form | Liquid |
| InChI | InChI=1S/C9H17NO2/c1-4-9(11)12-8-7-10(5-2)6-3/h4H,1,5-8H2,2-3H3 |
| InChIKey | QHVBLSNVXDSMEB-UHFFFAOYSA-N |
| SMILES | C(OCCN(CC)CC)(=O)C=C |
| CAS DataBase Reference | 2426-54-2(CAS DataBase Reference) |
| EPA Substance Registry System | 2-(Diethylamino)ethyl acrylate (2426-54-2) |
Description and Uses
Rodrigues et al. prepared novel temperature and pH-responsive copolymers of [2-(acryloyloxy)ethyl] trimethylammonium chloride (AEtMACl) and 2-(diethylamino)ethyl acrylate (DEAEA) by RAFT polymerization. Such copolymers show a volume phase transition temperature that explains the excellent performance of hydrogels of the same monomers, selected among 600 monomer combinations, to release cultured stem cells using only a mild temperature stimulus[1].
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H302-H310-H314-H317 |
| Precautionary statements | P261-P270-P280-P301+P312-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | 22-24-34-43 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2927 6.1/PG 2 |
| WGK Germany | 2 |
| RTECS | AS8225000 |
| F | 4.2-8-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Hazardous Substances Data | 2426-54-2(Hazardous Substances Data) |





