PRODUCT Properties
| Melting point: | 111-113 °C(lit.) |
| Boiling point: | 346.2±22.0 °C(Predicted) |
| Density | 1.264±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light |
| pka | 1.01±0.10(Predicted) |
| Appearance | Brown to reddish brown Solid |
| InChI | 1S/C8H10N2O3/c1-2-13-6-3-4-7(9)8(5-6)10(11)12/h3-5H,2,9H2,1H3 |
| InChIKey | ISFYBUAVOZFROB-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(N)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 616-86-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenamine, 4-ethoxy-2-nitro- (616-86-4) |
Description and Uses
4-Ethoxy-2-nitroaniline may be used in chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29222900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |







