BD0016656
2-Methoxy-5-nitroaniline , 98% , 99-59-2
Synonym(s):
5-Nitro-o-anisidine
CAS NO.:99-59-2
Empirical Formula: C7H8N2O3
Molecular Weight: 168.15
MDL number: MFCD00007261
EINECS: 202-770-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB68.00 | In Stock |
|
| 25g | RMB229.60 | In Stock |
|
| 100g | RMB559.20 | In Stock |
|
| 500g | RMB2724.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 117-119 °C(lit.) |
| Boiling point: | 337.07°C (rough estimate) |
| Density | 1.2068 |
| vapor pressure | 0.04Pa |
| refractive index | 1.6010 (estimate) |
| Flash point: | 119℃ |
| storage temp. | 2-8°C, protect from light |
| solubility | 382mg/L in organic solvents at 20 ℃ |
| pka | 2.42±0.10(Predicted) |
| Colour Index | 37130 |
| Appearance | Yellow to orange Solid |
| Water Solubility | Slightly soluble. <0.01 g/100 mL at 19.5 ºC |
| BRN | 879620 |
| Stability: | Stable, but may be moisture sensitive. Incompatible with water, acids, strong oxidizing agents, acid chlorides, acid anhydrides, chloroformates, liquid anisidine. |
| InChI | 1S/C7H8N2O3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,8H2,1H3 |
| InChIKey | NIPDVSLAMPAWTP-UHFFFAOYSA-N |
| SMILES | COc1ccc(cc1N)[N+]([O-])=O |
| LogP | 1.16 at 23℃ |
| CAS DataBase Reference | 99-59-2(CAS DataBase Reference) |
| IARC | 3 (Vol. 27, Sup 7) 1987 |
| NIST Chemistry Reference | Benzenamine, 2-methoxy-5-nitro-(99-59-2) |
| EPA Substance Registry System | 2-Methoxy-5-nitroaniline (99-59-2) |
Description and Uses
2-Methoxy-5-nitroaniline was used in the synthesis of 5-(9-acridinylamino)-p-anisidines via reaction with 9-anilinoacridines. It was also used in the synthesis of disazo disperse dyes containing nitro and methoxy groups, used for the dyeing of polyester fibre.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS06,GHS08,GHS07 |
| Signal word | Warning |
| Hazard statements | H301-H311-H332-H351-H302 |
| Precautionary statements | P201-P261-P280-P301+P310a-P405-P501a-P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-45-36/37 |
| WGK Germany | 2 |
| RTECS | BZ7175000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 2922290090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 99-59-2(Hazardous Substances Data) |







