BD0035153
(1R,3R)-Methyl1-(benzo[d][1,3]dioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylatehydrochloride , 97%HPLC , 171752-68-4
CAS NO.:171752-68-4
Empirical Formula: C20H19ClN2O4
Molecular Weight: 386.829
MDL number: MFCD09031373
EINECS: 1592732-453-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB36.80 | In Stock |
|
| 25g | RMB125.60 | In Stock |
|
| 100g | RMB414.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239-241 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly, Sonicated), Methanol (Slightly) |
| form | Solid |
| color | Off-White to Pale Yellow |
| Stability: | Hygroscopic |
| InChI | InChI=1/C20H18N2O4.ClH/c1-24-20(23)15-9-13-12-4-2-3-5-14(12)21-19(13)18(22-15)11-6-7-16-17(8-11)26-10-25-16;/h2-8,15,18,21-22H,9-10H2,1H3;1H/t15-,18-;/s3 |
| InChIKey | ROYJOKDTCKPQHK-QHWQFTOMNA-N |
| SMILES | C12[C@@H](C3=CC=C4OCOC4=C3)N[C@H](CC=1C1C(=CC=CC=1)N2)C(OC)=O.Cl |&1:1,12,r| |
Description and Uses
(1R,3R)-Methyl 1-(benzo[d][1,3]dioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate hydrochloride is a key pharmaceutical intermediate used in the synthesis of the drug tadalafil. Tadalafil is a phosphodiesterase 5 (PDE5) inhibitor primarily used to treat erectile dysfunction and benign prostatic hyperplasia in men.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |

![(1R,3R)-Methyl1-(benzo[d][1,3]dioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylatehydrochloride](https://img.chemicalbook.com/CAS/GIF/171752-68-4.gif)

![(1R,3R)-Methyl1-(benzo[d][1,3]dioxol-5-yl)-2-(2-chloroacetyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate](https://img.chemicalbook.com/CAS/GIF/171489-59-1.gif)


